C38H70O3 — CID 67804950
(2R,3R,4R)-2-methoxy-3-[[(1R,2R,6R)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethyl]-1,1-dimethyl-4-non-1-enylcyclohexane (PubChem CID 67804950) has the molecular formula C38H70O3 and a molecular weight of 574.98 g/mol. Its IUPAC name is (2R,3R,4R)-2-methoxy-3-[[(1R,2R,6R)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethyl]-1,1-dimethyl-4-non-1-enylcyclohexane.
| Compound Name | (2R,3R,4R)-2-methoxy-3-[[(1R,2R,6R)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethyl]-1,1-dimethyl-4-non-1-enylcyclohexane |
|---|---|
| PubChem CID | 67804950 |
| Molecular Formula | C38H70O3 |
| Molecular Weight | 574.98 g/mol |
| Exact Mass | 574.53 |
| IUPAC Name | (2R,3R,4R)-2-methoxy-3-[[(1R,2R,6R)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethyl]-1,1-dimethyl-4-non-1-enylcyclohexane |
| SMILES | CCCCCCCC=C[C@H]1CCC(C)(C)[C@H](OC)[C@H]1COC[C@@H]1[C@@H](OC)C(C)(C)CC[C@@H]1C=CCCCCCCC |
| InChI | InChI=1S/C38H70O3/c1-9-11-13-15-17-19-21-23-31-25-27-37(3,4)35(39-7)33(31)29-41-30-34-32(24-22-20-18-16-14-12-10-2)26-28-38(5,6)36(34)40-8/h21-24,31-36H,9-20,25-30H2,1-8H3/t31-,32-,33-,34-,35+,36+/m0/s1 |
| InChIKey | GKQRNJPZOSSNOR-GFWDPPTMSA-N |
| XLogP | 10.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.98 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|