C20H38O2 — CID 67805238
[(1R,2R,6R)-2-ethoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methanol (PubChem CID 67805238) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is [(1R,2R,6R)-2-ethoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methanol.
| Compound Name | [(1R,2R,6R)-2-ethoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methanol |
|---|---|
| PubChem CID | 67805238 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | [(1R,2R,6R)-2-ethoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methanol |
| SMILES | CCCCCCCC=C[C@H]1CCC(C)(C)[C@H](OCC)[C@H]1CO |
| InChI | InChI=1S/C20H38O2/c1-5-7-8-9-10-11-12-13-17-14-15-20(3,4)19(22-6-2)18(17)16-21/h12-13,17-19,21H,5-11,14-16H2,1-4H3/t17-,18-,19+/m0/s1 |
| InChIKey | PTZYLSBOBIIIES-GBESFXJTSA-N |
| XLogP | 5.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|