C14H25I — CID 163432728
cis-(2S,3R)-2-iodo-1-methyl-3-[(E)-oct-1-enyl]cyclopentane (PubChem CID 163432728) has the molecular formula C14H25I and a molecular weight of 320.26 g/mol. Its IUPAC name is cis-(2S,3R)-2-iodo-1-methyl-3-[(E)-oct-1-enyl]cyclopentane.
| Compound Name | cis-(2S,3R)-2-iodo-1-methyl-3-[(E)-oct-1-enyl]cyclopentane |
|---|---|
| PubChem CID | 163432728 |
| Molecular Formula | C14H25I |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | cis-(2S,3R)-2-iodo-1-methyl-3-[(E)-oct-1-enyl]cyclopentane |
| SMILES | CCCCCC/C=C/[C@H]1CCC(C)[C@@H]1I |
| InChI | InChI=1S/C14H25I/c1-3-4-5-6-7-8-9-13-11-10-12(2)14(13)15/h8-9,12-14H,3-7,10-11H2,1-2H3/b9-8+/t12?,13-,14-/m0/s1 |
| InChIKey | ARWRDCWAFQLAKY-GIAWPTDSSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|