C13H17FO3 — CID 91316153
(2R,3R,5S)-3-fluoro-5-methoxy-2-(phenylmethoxymethyl)oxolane (PubChem CID 91316153) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is (2R,3R,5S)-3-fluoro-5-methoxy-2-(phenylmethoxymethyl)oxolane.
| Compound Name | (2R,3R,5S)-3-fluoro-5-methoxy-2-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 91316153 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (2R,3R,5S)-3-fluoro-5-methoxy-2-(phenylmethoxymethyl)oxolane |
| SMILES | CO[C@@H]1C[C@@H](F)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C13H17FO3/c1-15-13-7-11(14)12(17-13)9-16-8-10-5-3-2-4-6-10/h2-6,11-13H,7-9H2,1H3/t11-,12-,13+/m1/s1 |
| InChIKey | XXYJTORLHFRZRM-UPJWGTAASA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |