C21H24O5 — CID 68926499
[(2S,3R)-5-methoxy-2-(phenylmethoxymethyl)oxolan-3-yl]methyl benzoate (PubChem CID 68926499) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(2S,3R)-5-methoxy-2-(phenylmethoxymethyl)oxolan-3-yl]methyl benzoate.
| Compound Name | [(2S,3R)-5-methoxy-2-(phenylmethoxymethyl)oxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 68926499 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(2S,3R)-5-methoxy-2-(phenylmethoxymethyl)oxolan-3-yl]methyl benzoate |
| SMILES | COC1C[C@H](COC(=O)c2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C21H24O5/c1-23-20-12-18(14-25-21(22)17-10-6-3-7-11-17)19(26-20)15-24-13-16-8-4-2-5-9-16/h2-11,18-20H,12-15H2,1H3/t18-,19-,20?/m1/s1 |
| InChIKey | HMRVPJPDGREMLL-LEAGNCFPSA-N |
| XLogP | 3.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |