C39H38F6O8 — CID 11585785
[(3S,4E,6E,12E)-3,14-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]tetradeca-4,6,12-trien-8,10-diynyl] 3-methylbutanoate (PubChem CID 11585785) has the molecular formula C39H38F6O8 and a molecular weight of 748.71 g/mol. Its IUPAC name is [(3S,4E,6E,12E)-3,14-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]tetradeca-4,6,12-trien-8,10-diynyl] 3-methylbutanoate.
| Compound Name | [(3S,4E,6E,12E)-3,14-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]tetradeca-4,6,12-trien-8,10-diynyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 11585785 |
| Molecular Formula | C39H38F6O8 |
| Molecular Weight | 748.71 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | [(3S,4E,6E,12E)-3,14-bis[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy]tetradeca-4,6,12-trien-8,10-diynyl] 3-methylbutanoate |
| SMILES | CO[C@@](C(=O)OC/C=C/C#CC#C/C=C/C=C/[C@H](CCOC(=O)CC(C)C)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C39H38F6O8/c1-29(2)28-33(46)51-27-25-32(53-35(48)37(50-4,39(43,44)45)31-22-16-13-17-23-31)24-18-10-8-6-5-7-9-11-19-26-52-34(47)36(49-3,38(40,41)42)30-20-14-12-15-21-30/h8,10-24,29,32H,25-28H2,1-4H3/b10-8+,19-11+,24-18+/t32-,36-,37-/m1/s1 |
| InChIKey | MCQCCDDBEWHHNH-GSRWVYSASA-N |
| XLogP | 7.30 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.71 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|