C37H36F6O6 — CID 44613663
[(2Z,8E,10E,14S)-14-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadeca-2,8,10-trien-4,6-diynyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 44613663) has the molecular formula C37H36F6O6 and a molecular weight of 690.68 g/mol. Its IUPAC name is [(2Z,8E,10E,14S)-14-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadeca-2,8,10-trien-4,6-diynyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2Z,8E,10E,14S)-14-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadeca-2,8,10-trien-4,6-diynyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 44613663 |
| Molecular Formula | C37H36F6O6 |
| Molecular Weight | 690.68 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | [(2Z,8E,10E,14S)-14-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyheptadeca-2,8,10-trien-4,6-diynyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCC[C@@H](CC/C=C/C=C/C#CC#C/C=C\COC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C37H36F6O6/c1-4-22-31(49-33(45)35(47-3,37(41,42)43)30-25-18-15-19-26-30)27-20-12-10-8-6-5-7-9-11-13-21-28-48-32(44)34(46-2,36(38,39)40)29-23-16-14-17-24-29/h6,8,10,12-19,21,23-26,31H,4,20,22,27-28H2,1-3H3/b8-6+,12-10+,21-13-/t31-,34-,35-/m0/s1 |
| InChIKey | XQCNBXAGZPPWJE-MRRSFLOCSA-N |
| XLogP | 7.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.68 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|