C36H50F2OSi — CID 23168652
tert-butyl-[(5Z,8Z,11E,14E)-6,9-difluoroicosa-5,8,11,14-tetraenoxy]-diphenylsilane (PubChem CID 23168652) has the molecular formula C36H50F2OSi and a molecular weight of 564.88 g/mol. Its IUPAC name is tert-butyl-[(5Z,8Z,11E,14E)-6,9-difluoroicosa-5,8,11,14-tetraenoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(5Z,8Z,11E,14E)-6,9-difluoroicosa-5,8,11,14-tetraenoxy]-diphenylsilane |
|---|---|
| PubChem CID | 23168652 |
| Molecular Formula | C36H50F2OSi |
| Molecular Weight | 564.88 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | tert-butyl-[(5Z,8Z,11E,14E)-6,9-difluoroicosa-5,8,11,14-tetraenoxy]-diphenylsilane |
| SMILES | CCCCC/C=C/C/C=C/C/C(F)=C/C/C(F)=C/CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H50F2OSi/c1-5-6-7-8-9-10-11-12-16-23-32(37)29-30-33(38)24-17-15-22-31-39-40(36(2,3)4,34-25-18-13-19-26-34)35-27-20-14-21-28-35/h9-10,12-14,16,18-21,24-29H,5-8,11,15,17,22-23,30-31H2,1-4H3/b10-9+,16-12+,32-29-,33-24- |
| InChIKey | XRTBIWOFRYIFKU-UIZSVNRHSA-N |
| XLogP | 10.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.88 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|