C39H64O5Si2 — CID 57409648
(2S,3S,4S,5R)-2-[(2Z,4E,6R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methylhepta-2,4-dienyl]-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexane-1,4-diol (PubChem CID 57409648) has the molecular formula C39H64O5Si2 and a molecular weight of 669.11 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[(2Z,4E,6R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methylhepta-2,4-dienyl]-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexane-1,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-[(2Z,4E,6R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methylhepta-2,4-dienyl]-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexane-1,4-diol |
|---|---|
| PubChem CID | 57409648 |
| Molecular Formula | C39H64O5Si2 |
| Molecular Weight | 669.11 g/mol |
| Exact Mass | 668.43 |
| IUPAC Name | (2S,3S,4S,5R)-2-[(2Z,4E,6R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methylhepta-2,4-dienyl]-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexane-1,4-diol |
| SMILES | CO[C@H](/C=C/C=C(/C)C[C@H](CO)[C@H](C)[C@H](O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H64O5Si2/c1-30(20-19-21-34(42-10)29-43-45(11,12)38(4,5)6)26-33(27-40)32(3)37(41)31(2)28-44-46(39(7,8)9,35-22-15-13-16-23-35)36-24-17-14-18-25-36/h13-25,31-34,37,40-41H,26-29H2,1-12H3/b21-19+,30-20-/t31-,32+,33-,34-,37-/m1/s1 |
| InChIKey | QQFZCUJMYYHYQG-QEUQORNCSA-N |
| XLogP | 7.73 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.11 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|