C32H52O4Si2 — CID 11398826
(Z,5R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyloct-2-ene-1,8-diol (PubChem CID 11398826) has the molecular formula C32H52O4Si2 and a molecular weight of 556.94 g/mol. Its IUPAC name is (Z,5R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyloct-2-ene-1,8-diol.
| Compound Name | (Z,5R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyloct-2-ene-1,8-diol |
|---|---|
| PubChem CID | 11398826 |
| Molecular Formula | C32H52O4Si2 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | (Z,5R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyloct-2-ene-1,8-diol |
| SMILES | C/C(=C/C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)[C@H](CO)O[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C32H52O4Si2/c1-25(23-33)21-22-29(26(2)30(24-34)35-37(9,10)31(3,4)5)36-38(32(6,7)8,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-21,26,29-30,33-34H,22-24H2,1-10H3/b25-21-/t26-,29+,30-/m0/s1 |
| InChIKey | HYWMMYBGYYRXKG-WHOTYHBXSA-N |
| XLogP | 6.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|