C23H38N2O4 — CID 145199584
tert-butyl N-[(E)-4-(dimethylamino)-2-methyl-4-oxobut-2-enyl]-N-[2-(4-methylphenoxy)ethyl]carbamate;ethane (PubChem CID 145199584) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-(dimethylamino)-2-methyl-4-oxobut-2-enyl]-N-[2-(4-methylphenoxy)ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[(E)-4-(dimethylamino)-2-methyl-4-oxobut-2-enyl]-N-[2-(4-methylphenoxy)ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 145199584 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | tert-butyl N-[(E)-4-(dimethylamino)-2-methyl-4-oxobut-2-enyl]-N-[2-(4-methylphenoxy)ethyl]carbamate;ethane |
| SMILES | C/C(=C\C(=O)N(C)C)CN(CCOc1ccc(C)cc1)C(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C21H32N2O4.C2H6/c1-16-8-10-18(11-9-16)26-13-12-23(20(25)27-21(3,4)5)15-17(2)14-19(24)22(6)7;1-2/h8-11,14H,12-13,15H2,1-7H3;1-2H3/b17-14+; |
| InChIKey | WKIROCSTFYUXTM-KLSJZZFUSA-N |
| XLogP | 4.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|