C17H23IN2O5 — CID 134528510
methyl (E)-4-[2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-2-enoate (PubChem CID 134528510) has the molecular formula C17H23IN2O5 and a molecular weight of 462.28 g/mol. Its IUPAC name is methyl (E)-4-[2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 134528510 |
| Molecular Formula | C17H23IN2O5 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | methyl (E)-4-[2-[(5-iodo-2-pyridinyl)oxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CN(CCOc1ccc(I)cn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23IN2O5/c1-17(2,3)25-16(22)20(9-5-6-15(21)23-4)10-11-24-14-8-7-13(18)12-19-14/h5-8,12H,9-11H2,1-4H3/b6-5+ |
| InChIKey | FZJYOMLQLFNAOW-AATRIKPKSA-N |
| XLogP | 3.03 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|