C14H17IN2O4 — CID 134519328
2-(4-iodophenoxy)ethyl-[(E)-4-(methylamino)-4-oxobut-2-enyl]carbamic acid (PubChem CID 134519328) has the molecular formula C14H17IN2O4 and a molecular weight of 404.20 g/mol. Its IUPAC name is 2-(4-iodophenoxy)ethyl-[(E)-4-(methylamino)-4-oxobut-2-enyl]carbamic acid.
| Compound Name | 2-(4-iodophenoxy)ethyl-[(E)-4-(methylamino)-4-oxobut-2-enyl]carbamic acid |
|---|---|
| PubChem CID | 134519328 |
| Molecular Formula | C14H17IN2O4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 2-(4-iodophenoxy)ethyl-[(E)-4-(methylamino)-4-oxobut-2-enyl]carbamic acid |
| SMILES | CNC(=O)/C=C/CN(CCOc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C14H17IN2O4/c1-16-13(18)3-2-8-17(14(19)20)9-10-21-12-6-4-11(15)5-7-12/h2-7H,8-10H2,1H3,(H,16,18)(H,19,20)/b3-2+ |
| InChIKey | WQWZATVQUZRUJU-NSCUHMNNSA-N |
| XLogP | 1.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|