C11H15IN2O2 — CID 100743856
3-[2-(4-iodophenoxy)ethyl]-1,1-dimethylurea (PubChem CID 100743856) has the molecular formula C11H15IN2O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 3-[2-(4-iodophenoxy)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(4-iodophenoxy)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 100743856 |
| Molecular Formula | C11H15IN2O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-[2-(4-iodophenoxy)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCOc1ccc(I)cc1 |
| InChI | InChI=1S/C11H15IN2O2/c1-14(2)11(15)13-7-8-16-10-5-3-9(12)4-6-10/h3-6H,7-8H2,1-2H3,(H,13,15) |
| InChIKey | STHMATIPUHCGAS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|