C12H18N2O3 — CID 173040032
1-(2-methoxyethyl)-1-(2-phenoxyethyl)urea (PubChem CID 173040032) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1-(2-phenoxyethyl)urea.
| Compound Name | 1-(2-methoxyethyl)-1-(2-phenoxyethyl)urea |
|---|---|
| PubChem CID | 173040032 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-(2-methoxyethyl)-1-(2-phenoxyethyl)urea |
| SMILES | COCCN(CCOc1ccccc1)C(N)=O |
| InChI | InChI=1S/C12H18N2O3/c1-16-9-7-14(12(13)15)8-10-17-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H2,13,15) |
| InChIKey | LBVNJMQTGHLCRL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |