C15H22BrNO4 — CID 55348926
3-(3-bromophenoxy)-N,N-bis(2-methoxyethyl)propanamide (PubChem CID 55348926) has the molecular formula C15H22BrNO4 and a molecular weight of 360.25 g/mol. Its IUPAC name is 3-(3-bromophenoxy)-N,N-bis(2-methoxyethyl)propanamide.
| Compound Name | 3-(3-bromophenoxy)-N,N-bis(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 55348926 |
| Molecular Formula | C15H22BrNO4 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-(3-bromophenoxy)-N,N-bis(2-methoxyethyl)propanamide |
| SMILES | COCCN(CCOC)C(=O)CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C15H22BrNO4/c1-19-10-7-17(8-11-20-2)15(18)6-9-21-14-5-3-4-13(16)12-14/h3-5,12H,6-11H2,1-2H3 |
| InChIKey | URIICYJAMMYQNP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |