C14H20BrNO3 — CID 62012123
methyl 4-[2-(3-bromophenoxy)ethyl-methylamino]butanoate (PubChem CID 62012123) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is methyl 4-[2-(3-bromophenoxy)ethyl-methylamino]butanoate.
| Compound Name | methyl 4-[2-(3-bromophenoxy)ethyl-methylamino]butanoate |
|---|---|
| PubChem CID | 62012123 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 4-[2-(3-bromophenoxy)ethyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C14H20BrNO3/c1-16(8-4-7-14(17)18-2)9-10-19-13-6-3-5-12(15)11-13/h3,5-6,11H,4,7-10H2,1-2H3 |
| InChIKey | VYVYPLIEVIHPFO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |