C34H36F4N6O — CID 175191761
N,N-dimethyl-4-[methyl-[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-enamide (PubChem CID 175191761) has the molecular formula C34H36F4N6O and a molecular weight of 620.70 g/mol. Its IUPAC name is N,N-dimethyl-4-[methyl-[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-enamide.
| Compound Name | N,N-dimethyl-4-[methyl-[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-enamide |
|---|---|
| PubChem CID | 175191761 |
| Molecular Formula | C34H36F4N6O |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | N,N-dimethyl-4-[methyl-[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-enamide |
| SMILES | CN(C)C(=O)C=CCN(C)C1CCCN(c2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1 |
| InChI | InChI=1S/C34H36F4N6O/c1-42(2)31(45)12-8-17-43(3)26-11-7-18-44(22-26)30-16-14-25(21-39-30)32(24-13-15-29-27(19-24)33(35)41-40-29)28(20-34(36,37)38)23-9-5-4-6-10-23/h4-6,8-10,12-16,19,21,26H,7,11,17-18,20,22H2,1-3H3,(H,40,41)/b12-8?,32-28- |
| InChIKey | VVAUDBGWPOWHQI-OIVVJMPWSA-N |
| XLogP | 6.55 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|