C33H34F4N6O — CID 155429927
(E)-N,N-dimethyl-4-[[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-4-yl]amino]but-2-enamide (PubChem CID 155429927) has the molecular formula C33H34F4N6O and a molecular weight of 606.67 g/mol. Its IUPAC name is (E)-N,N-dimethyl-4-[[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-4-yl]amino]but-2-enamide.
| Compound Name | (E)-N,N-dimethyl-4-[[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-4-yl]amino]but-2-enamide |
|---|---|
| PubChem CID | 155429927 |
| Molecular Formula | C33H34F4N6O |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (E)-N,N-dimethyl-4-[[1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-4-yl]amino]but-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CNC1CCN(c2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)CC1 |
| InChI | InChI=1S/C33H34F4N6O/c1-42(2)30(44)9-6-16-38-25-14-17-43(18-15-25)29-13-11-24(21-39-29)31(23-10-12-28-26(19-23)32(34)41-40-28)27(20-33(35,36)37)22-7-4-3-5-8-22/h3-13,19,21,25,38H,14-18,20H2,1-2H3,(H,40,41)/b9-6+,31-27- |
| InChIKey | VTJQYEKQDATQHK-PKSKTZBOSA-N |
| XLogP | 6.21 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|