C36H38F4N6O — CID 167533054
(E)-1-piperidin-1-yl-4-[[(3S)-1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-en-1-one (PubChem CID 167533054) has the molecular formula C36H38F4N6O and a molecular weight of 646.73 g/mol. Its IUPAC name is (E)-1-piperidin-1-yl-4-[[(3S)-1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-en-1-one.
| Compound Name | (E)-1-piperidin-1-yl-4-[[(3S)-1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-en-1-one |
|---|---|
| PubChem CID | 167533054 |
| Molecular Formula | C36H38F4N6O |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | (E)-1-piperidin-1-yl-4-[[(3S)-1-[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]piperidin-3-yl]amino]but-2-en-1-one |
| SMILES | O=C(/C=C/CN[C@H]1CCCN(c2ccc(/C(=C(/CC(F)(F)F)c3ccccc3)c3ccc4n[nH]c(F)c4c3)cn2)C1)N1CCCCC1 |
| InChI | InChI=1S/C36H38F4N6O/c37-35-29-21-26(13-15-31(29)43-44-35)34(30(22-36(38,39)40)25-9-3-1-4-10-25)27-14-16-32(42-23-27)46-20-8-11-28(24-46)41-17-7-12-33(47)45-18-5-2-6-19-45/h1,3-4,7,9-10,12-16,21,23,28,41H,2,5-6,8,11,17-20,22,24H2,(H,43,44)/b12-7+,34-30-/t28-/m0/s1 |
| InChIKey | YLJJTGWKPJVALG-LETFCDMWSA-N |
| XLogP | 7.14 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|