C31H28F4N2O5 — CID 134544039
2-[4-[4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl hydrogen carbonate (PubChem CID 134544039) has the molecular formula C31H28F4N2O5 and a molecular weight of 584.57 g/mol. Its IUPAC name is 2-[4-[4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl hydrogen carbonate.
| Compound Name | 2-[4-[4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 134544039 |
| Molecular Formula | C31H28F4N2O5 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 2-[4-[4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenoxy]ethyl hydrogen carbonate |
| SMILES | O=C(O)OCCOc1ccc(C(=C(CC(F)(F)F)c2ccccc2)c2ccc3c(c2)c(F)nn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C31H28F4N2O5/c32-29-24-18-22(11-14-26(24)37(36-29)27-8-4-5-15-41-27)28(25(19-31(33,34)35)20-6-2-1-3-7-20)21-9-12-23(13-10-21)40-16-17-42-30(38)39/h1-3,6-7,9-14,18,27H,4-5,8,15-17,19H2,(H,38,39) |
| InChIKey | GZAGNJBGXYVYQG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|