C26H28FN3O7S — CID 155618368
tert-butyl N-[2-[5-fluoro-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate (PubChem CID 155618368) has the molecular formula C26H28FN3O7S and a molecular weight of 545.59 g/mol. Its IUPAC name is tert-butyl N-[2-[5-fluoro-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-fluoro-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 155618368 |
| Molecular Formula | C26H28FN3O7S |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | tert-butyl N-[2-[5-fluoro-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2c(F)c(N3CC(=O)NS3(=O)=O)c(OCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C26H28FN3O7S/c1-26(2,3)37-25(32)28-11-12-35-19-9-10-20-18(13-19)14-21(36-16-17-7-5-4-6-8-17)24(23(20)27)30-15-22(31)29-38(30,33)34/h4-10,13-14H,11-12,15-16H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | VHRCCAAGIRVJAG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|