C29H30FN3O6S — CID 155764380
tert-butyl 4-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 155764380) has the molecular formula C29H30FN3O6S and a molecular weight of 567.64 g/mol. Its IUPAC name is tert-butyl 4-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 155764380 |
| Molecular Formula | C29H30FN3O6S |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | tert-butyl 4-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2ccc3cc(OCc4ccccc4)c(N4CC(=O)NS4(=O)=O)c(F)c3c2)CC1 |
| InChI | InChI=1S/C29H30FN3O6S/c1-29(2,3)39-28(35)32-13-11-20(12-14-32)21-9-10-22-16-24(38-18-19-7-5-4-6-8-19)27(26(30)23(22)15-21)33-17-25(34)31-40(33,36)37/h4-11,15-16H,12-14,17-18H2,1-3H3,(H,31,34) |
| InChIKey | IBGAGEKZVQJXFZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |