C27H28FN3O9S3 — CID 156506642
3-[[3-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,5-dihydropyrrol-1-yl]sulfonyl]propyl methanesulfonate (PubChem CID 156506642) has the molecular formula C27H28FN3O9S3 and a molecular weight of 653.73 g/mol. Its IUPAC name is 3-[[3-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,5-dihydropyrrol-1-yl]sulfonyl]propyl methanesulfonate.
| Compound Name | 3-[[3-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,5-dihydropyrrol-1-yl]sulfonyl]propyl methanesulfonate |
|---|---|
| PubChem CID | 156506642 |
| Molecular Formula | C27H28FN3O9S3 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 653.10 |
| IUPAC Name | 3-[[3-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,5-dihydropyrrol-1-yl]sulfonyl]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCS(=O)(=O)N1CC=C(c2ccc3cc(OCc4ccccc4)c(N4CC(=O)NS4(=O)=O)c(F)c3c2)C1 |
| InChI | InChI=1S/C27H28FN3O9S3/c1-41(33,34)40-12-5-13-42(35,36)30-11-10-22(16-30)20-8-9-21-15-24(39-18-19-6-3-2-4-7-19)27(26(28)23(21)14-20)31-17-25(32)29-43(31,37)38/h2-4,6-10,14-15H,5,11-13,16-18H2,1H3,(H,29,32) |
| InChIKey | GJVIGVZLFCMVQR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|