C19H19FN6O6S2 — CID 156506444
5-[7-[1-(3-azidopropylsulfonyl)-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 156506444) has the molecular formula C19H19FN6O6S2 and a molecular weight of 510.53 g/mol. Its IUPAC name is 5-[7-[1-(3-azidopropylsulfonyl)-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[7-[1-(3-azidopropylsulfonyl)-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 156506444 |
| Molecular Formula | C19H19FN6O6S2 |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 5-[7-[1-(3-azidopropylsulfonyl)-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | [N-]=[N+]=NCCCS(=O)(=O)N1CC=C(c2ccc3cc(O)c(N4CC(=O)NS4(=O)=O)c(F)c3c2)C1 |
| InChI | InChI=1S/C19H19FN6O6S2/c20-18-15-8-12(14-4-6-25(10-14)33(29,30)7-1-5-22-24-21)2-3-13(15)9-16(27)19(18)26-11-17(28)23-34(26,31)32/h2-4,8-9,27H,1,5-7,10-11H2,(H,23,28) |
| InChIKey | JPIAQKNGSWXZSO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 172.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|