C21H20FN5O6S2 — CID 155485098
5-[7-[1-(1,3-dimethylpyrazol-4-yl)sulfonyl-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155485098) has the molecular formula C21H20FN5O6S2 and a molecular weight of 521.55 g/mol. Its IUPAC name is 5-[7-[1-(1,3-dimethylpyrazol-4-yl)sulfonyl-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[7-[1-(1,3-dimethylpyrazol-4-yl)sulfonyl-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155485098 |
| Molecular Formula | C21H20FN5O6S2 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 5-[7-[1-(1,3-dimethylpyrazol-4-yl)sulfonyl-2,5-dihydropyrrol-3-yl]-1-fluoro-3-hydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CC=C(c2ccc3cc(O)c(N4CC(=O)NS4(=O)=O)c(F)c3c2)C1 |
| InChI | InChI=1S/C21H20FN5O6S2/c1-12-18(10-25(2)23-12)34(30,31)26-6-5-15(9-26)13-3-4-14-8-17(28)21(20(22)16(14)7-13)27-11-19(29)24-35(27,32)33/h3-5,7-8,10,28H,6,9,11H2,1-2H3,(H,24,29) |
| InChIKey | KUGZQBNNYMNVOC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |