C12H19N3O2S — CID 155484923
1,3-dimethyl-4-[(3-propan-2-yl-2,5-dihydropyrrol-1-yl)sulfonyl]pyrazole (PubChem CID 155484923) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 1,3-dimethyl-4-[(3-propan-2-yl-2,5-dihydropyrrol-1-yl)sulfonyl]pyrazole.
| Compound Name | 1,3-dimethyl-4-[(3-propan-2-yl-2,5-dihydropyrrol-1-yl)sulfonyl]pyrazole |
|---|---|
| PubChem CID | 155484923 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1,3-dimethyl-4-[(3-propan-2-yl-2,5-dihydropyrrol-1-yl)sulfonyl]pyrazole |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CC=C(C(C)C)C1 |
| InChI | InChI=1S/C12H19N3O2S/c1-9(2)11-5-6-15(7-11)18(16,17)12-8-14(4)13-10(12)3/h5,8-9H,6-7H2,1-4H3 |
| InChIKey | ABEWVDGDEGNSBH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|