C16H26N6O4S2 — CID 98337206
(2R,5R)-1,4-bis[(1,3-dimethylpyrazol-4-yl)sulfonyl]-2,5-dimethylpiperazine (PubChem CID 98337206) has the molecular formula C16H26N6O4S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is (2R,5R)-1,4-bis[(1,3-dimethylpyrazol-4-yl)sulfonyl]-2,5-dimethylpiperazine.
| Compound Name | (2R,5R)-1,4-bis[(1,3-dimethylpyrazol-4-yl)sulfonyl]-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 98337206 |
| Molecular Formula | C16H26N6O4S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (2R,5R)-1,4-bis[(1,3-dimethylpyrazol-4-yl)sulfonyl]-2,5-dimethylpiperazine |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1C[C@@H](C)N(S(=O)(=O)c2cn(C)nc2C)C[C@H]1C |
| InChI | InChI=1S/C16H26N6O4S2/c1-11-7-22(28(25,26)16-10-20(6)18-14(16)4)12(2)8-21(11)27(23,24)15-9-19(5)17-13(15)3/h9-12H,7-8H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | HOBJHEDKKSKXIL-VXGBXAGGSA-N |
| XLogP | 0.24 |
| TPSA | 110.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |