C19H30N4O2S — CID 22202157
1-(2-adamantyl)-4-(1,3-dimethylpyrazol-4-yl)sulfonylpiperazine (PubChem CID 22202157) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-(1,3-dimethylpyrazol-4-yl)sulfonylpiperazine.
| Compound Name | 1-(2-adamantyl)-4-(1,3-dimethylpyrazol-4-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 22202157 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-(2-adamantyl)-4-(1,3-dimethylpyrazol-4-yl)sulfonylpiperazine |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CCN(C2C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C19H30N4O2S/c1-13-18(12-21(2)20-13)26(24,25)23-5-3-22(4-6-23)19-16-8-14-7-15(10-16)11-17(19)9-14/h12,14-17,19H,3-11H2,1-2H3 |
| InChIKey | JBRWGLQHGPGXNY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |