C20H26F2N2O2S — CID 22202137
1-(2-adamantyl)-4-(2,4-difluorophenyl)sulfonylpiperazine (PubChem CID 22202137) has the molecular formula C20H26F2N2O2S and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-(2,4-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(2-adamantyl)-4-(2,4-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 22202137 |
| Molecular Formula | C20H26F2N2O2S |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-(2-adamantyl)-4-(2,4-difluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCN(C2C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C20H26F2N2O2S/c21-17-1-2-19(18(22)12-17)27(25,26)24-5-3-23(4-6-24)20-15-8-13-7-14(10-15)11-16(20)9-13/h1-2,12-16,20H,3-11H2 |
| InChIKey | WOYZKVPOKAEAHJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |