C30H25FN4O8S2 — CID 155764430
5-[1-fluoro-7-[1-[(4-nitrophenyl)methylsulfonyl]-2,5-dihydropyrrol-3-yl]-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155764430) has the molecular formula C30H25FN4O8S2 and a molecular weight of 652.68 g/mol. Its IUPAC name is 5-[1-fluoro-7-[1-[(4-nitrophenyl)methylsulfonyl]-2,5-dihydropyrrol-3-yl]-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[1-fluoro-7-[1-[(4-nitrophenyl)methylsulfonyl]-2,5-dihydropyrrol-3-yl]-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155764430 |
| Molecular Formula | C30H25FN4O8S2 |
| Molecular Weight | 652.68 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | 5-[1-fluoro-7-[1-[(4-nitrophenyl)methylsulfonyl]-2,5-dihydropyrrol-3-yl]-3-phenylmethoxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(OCc3ccccc3)cc3ccc(C4=CCN(S(=O)(=O)Cc5ccc([N+](=O)[O-])cc5)C4)cc3c2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C30H25FN4O8S2/c31-29-26-14-22(24-12-13-33(16-24)44(39,40)19-21-6-10-25(11-7-21)35(37)38)8-9-23(26)15-27(43-18-20-4-2-1-3-5-20)30(29)34-17-28(36)32-45(34,41)42/h1-12,14-15H,13,16-19H2,(H,32,36) |
| InChIKey | VTUGFTOBJNHJIU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|