C20H20FN3O7S — CID 162756739
5-[1-fluoro-7-hydroxy-7-(nitromethyl)-3-phenylmethoxy-6,8-dihydro-5H-naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 162756739) has the molecular formula C20H20FN3O7S and a molecular weight of 465.46 g/mol. Its IUPAC name is 5-[1-fluoro-7-hydroxy-7-(nitromethyl)-3-phenylmethoxy-6,8-dihydro-5H-naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[1-fluoro-7-hydroxy-7-(nitromethyl)-3-phenylmethoxy-6,8-dihydro-5H-naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 162756739 |
| Molecular Formula | C20H20FN3O7S |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 5-[1-fluoro-7-hydroxy-7-(nitromethyl)-3-phenylmethoxy-6,8-dihydro-5H-naphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(OCc3ccccc3)cc3c(c2F)CC(O)(C[N+](=O)[O-])CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C20H20FN3O7S/c21-18-15-9-20(26,12-24(27)28)7-6-14(15)8-16(31-11-13-4-2-1-3-5-13)19(18)23-10-17(25)22-32(23,29)30/h1-5,8,26H,6-7,9-12H2,(H,22,25) |
| InChIKey | IUZNZKAEHPUQNK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|