C24H29FN4O4S — CID 155103363
N'-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylbutanimidamide (PubChem CID 155103363) has the molecular formula C24H29FN4O4S and a molecular weight of 488.59 g/mol. Its IUPAC name is N'-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylbutanimidamide.
| Compound Name | N'-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylbutanimidamide |
|---|---|
| PubChem CID | 155103363 |
| Molecular Formula | C24H29FN4O4S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N'-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylbutanimidamide |
| SMILES | CC(C)C/C(N)=N\C1CCc2cc(OCc3ccccc3)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C24H29FN4O4S/c1-15(2)10-21(26)27-18-9-8-17-11-20(33-14-16-6-4-3-5-7-16)24(23(25)19(17)12-18)29-13-22(30)28-34(29,31)32/h3-7,11,15,18H,8-10,12-14H2,1-2H3,(H2,26,27)(H,28,30) |
| InChIKey | PZGBACSCHLNWQV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|