C21H19FN2O6S — CID 169225246
5-(1'-fluoro-3'-phenylmethoxyspiro[1,3-dioxole-2,7'-6,8-dihydro-5H-naphthalene]-2'-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 169225246) has the molecular formula C21H19FN2O6S and a molecular weight of 446.46 g/mol. Its IUPAC name is 5-(1'-fluoro-3'-phenylmethoxyspiro[1,3-dioxole-2,7'-6,8-dihydro-5H-naphthalene]-2'-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-(1'-fluoro-3'-phenylmethoxyspiro[1,3-dioxole-2,7'-6,8-dihydro-5H-naphthalene]-2'-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 169225246 |
| Molecular Formula | C21H19FN2O6S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 5-(1'-fluoro-3'-phenylmethoxyspiro[1,3-dioxole-2,7'-6,8-dihydro-5H-naphthalene]-2'-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(OCc3ccccc3)cc3c(c2F)CC2(CC3)OC=CO2)S(=O)(=O)N1 |
| InChI | InChI=1S/C21H19FN2O6S/c22-19-16-11-21(29-8-9-30-21)7-6-15(16)10-17(28-13-14-4-2-1-3-5-14)20(19)24-12-18(25)23-31(24,26)27/h1-5,8-10H,6-7,11-13H2,(H,23,25) |
| InChIKey | OFUKPZWDANLYCL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |