C24H25FN4O6S — CID 162720181
8-fluoro-N-(oxolan-2-ylidenemethyl)-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 162720181) has the molecular formula C24H25FN4O6S and a molecular weight of 516.55 g/mol. Its IUPAC name is 8-fluoro-N-(oxolan-2-ylidenemethyl)-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 8-fluoro-N-(oxolan-2-ylidenemethyl)-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 162720181 |
| Molecular Formula | C24H25FN4O6S |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 8-fluoro-N-(oxolan-2-ylidenemethyl)-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C1CN(c2c(OCc3ccccc3)cc3c(c2F)CN(C(=O)NC=C2CCCO2)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C24H25FN4O6S/c25-22-19-13-28(24(31)26-12-18-7-4-10-34-18)9-8-17(19)11-20(35-15-16-5-2-1-3-6-16)23(22)29-14-21(30)27-36(29,32)33/h1-3,5-6,11-12H,4,7-10,13-15H2,(H,26,31)(H,27,30) |
| InChIKey | AUAXLMSLJZAKDV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |