C29H38FN3O6S — CID 155618451
tert-butyl (3S)-5-fluoro-3-(4-methylpentyl)-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 155618451) has the molecular formula C29H38FN3O6S and a molecular weight of 575.70 g/mol. Its IUPAC name is tert-butyl (3S)-5-fluoro-3-(4-methylpentyl)-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (3S)-5-fluoro-3-(4-methylpentyl)-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 155618451 |
| Molecular Formula | C29H38FN3O6S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | tert-butyl (3S)-5-fluoro-3-(4-methylpentyl)-7-phenylmethoxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)CCC[C@H]1Cc2c(cc(OCc3ccccc3)c(N3CC(=O)NS3(=O)=O)c2F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H38FN3O6S/c1-19(2)10-9-13-22-15-23-21(16-32(22)28(35)39-29(3,4)5)14-24(38-18-20-11-7-6-8-12-20)27(26(23)30)33-17-25(34)31-40(33,36)37/h6-8,11-12,14,19,22H,9-10,13,15-18H2,1-5H3,(H,31,34)/t22-/m0/s1 |
| InChIKey | XJSPNNYAAGHPGI-QFIPXVFZSA-N |
| XLogP | 5.07 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |