C23H27FN4O5S — CID 162720197
N-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pentanamide (PubChem CID 162720197) has the molecular formula C23H27FN4O5S and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pentanamide.
| Compound Name | N-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pentanamide |
|---|---|
| PubChem CID | 162720197 |
| Molecular Formula | C23H27FN4O5S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[8-fluoro-6-phenylmethoxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pentanamide |
| SMILES | CCCCC(=O)NN1CCc2cc(OCc3ccccc3)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C23H27FN4O5S/c1-2-3-9-20(29)25-27-11-10-17-12-19(33-15-16-7-5-4-6-8-16)23(22(24)18(17)13-27)28-14-21(30)26-34(28,31)32/h4-8,12H,2-3,9-11,13-15H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | VAWIRFJAIYZUCD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |