C17H24FN5O5S — CID 155103467
N-[3-(dimethylamino)propyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 155103467) has the molecular formula C17H24FN5O5S and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 155103467 |
| Molecular Formula | C17H24FN5O5S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)N1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C17H24FN5O5S/c1-21(2)6-3-5-19-17(26)22-7-4-11-8-13(24)16(15(18)12(11)9-22)23-10-14(25)20-29(23,27)28/h8,24H,3-7,9-10H2,1-2H3,(H,19,26)(H,20,25) |
| InChIKey | WTYDJECFEQYFRT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|