C12H14FN3O4S — CID 155103468
5-[(7R)-7-amino-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103468) has the molecular formula C12H14FN3O4S and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-[(7R)-7-amino-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-7-amino-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103468 |
| Molecular Formula | C12H14FN3O4S |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-[(7R)-7-amino-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | N[C@@H]1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C12H14FN3O4S/c13-11-8-4-7(14)2-1-6(8)3-9(17)12(11)16-5-10(18)15-21(16,19)20/h3,7,17H,1-2,4-5,14H2,(H,15,18)/t7-/m1/s1 |
| InChIKey | ZSUAHRWNJZHBMU-SSDOTTSWSA-N |
| XLogP | -0.47 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |