C17H24FN3O4S — CID 169128171
5-[7-[2-(dimethylamino)ethyl]-4-fluoro-2-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 169128171) has the molecular formula C17H24FN3O4S and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-[7-[2-(dimethylamino)ethyl]-4-fluoro-2-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[7-[2-(dimethylamino)ethyl]-4-fluoro-2-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 169128171 |
| Molecular Formula | C17H24FN3O4S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 5-[7-[2-(dimethylamino)ethyl]-4-fluoro-2-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CN(C)CCC1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2CC1 |
| InChI | InChI=1S/C17H24FN3O4S/c1-20(2)8-7-11-3-5-12-9-14(22)17(16(18)13(12)6-4-11)21-10-15(23)19-26(21,24)25/h9,11,22H,3-8,10H2,1-2H3,(H,19,23) |
| InChIKey | FZRZAVRUWZFFGN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |