C20H26FN5O4S — CID 155103151
5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103151) has the molecular formula C20H26FN5O4S and a molecular weight of 451.52 g/mol. Its IUPAC name is 5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103151 |
| Molecular Formula | C20H26FN5O4S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CCn1nc(C)c(CCN2CCc3cc(O)c(N4CC(=O)NS4(=O)=O)c(F)c3C2)c1C |
| InChI | InChI=1S/C20H26FN5O4S/c1-4-25-13(3)15(12(2)22-25)6-8-24-7-5-14-9-17(27)20(19(21)16(14)10-24)26-11-18(28)23-31(26,29)30/h9,27H,4-8,10-11H2,1-3H3,(H,23,28) |
| InChIKey | DDZJSQIBDIEBPY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |