C27H32FN5O4S — CID 155103447
5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-phenylmethoxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103447) has the molecular formula C27H32FN5O4S and a molecular weight of 541.65 g/mol. Its IUPAC name is 5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-phenylmethoxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-phenylmethoxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103447 |
| Molecular Formula | C27H32FN5O4S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 5-[2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-phenylmethoxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CCn1nc(C)c(CCN2CCc3cc(OCc4ccccc4)c(N4CC(=O)NS4(=O)=O)c(F)c3C2)c1C |
| InChI | InChI=1S/C27H32FN5O4S/c1-4-32-19(3)22(18(2)29-32)11-13-31-12-10-21-14-24(37-17-20-8-6-5-7-9-20)27(26(28)23(21)15-31)33-16-25(34)30-38(33,35)36/h5-9,14H,4,10-13,15-17H2,1-3H3,(H,30,34) |
| InChIKey | ZUNRMGLWMNVYAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |