C19H22FN3O7S — CID 156518126
tert-butyl N-[2-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate (PubChem CID 156518126) has the molecular formula C19H22FN3O7S and a molecular weight of 455.46 g/mol. Its IUPAC name is tert-butyl N-[2-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 156518126 |
| Molecular Formula | C19H22FN3O7S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | tert-butyl N-[2-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2c1 |
| InChI | InChI=1S/C19H22FN3O7S/c1-19(2,3)30-18(26)21-6-7-29-12-5-4-11-8-14(24)17(16(20)13(11)9-12)23-10-15(25)22-31(23,27)28/h4-5,8-9,24H,6-7,10H2,1-3H3,(H,21,26)(H,22,25) |
| InChIKey | CFGGVXSKHUOPJW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|