C24H30FN3O8S — CID 155764496
tert-butyl 3-[8-fluoro-6-(2-methoxyethoxymethoxy)-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]azetidine-1-carboxylate (PubChem CID 155764496) has the molecular formula C24H30FN3O8S and a molecular weight of 539.58 g/mol. Its IUPAC name is tert-butyl 3-[8-fluoro-6-(2-methoxyethoxymethoxy)-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[8-fluoro-6-(2-methoxyethoxymethoxy)-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 155764496 |
| Molecular Formula | C24H30FN3O8S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | tert-butyl 3-[8-fluoro-6-(2-methoxyethoxymethoxy)-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]azetidine-1-carboxylate |
| SMILES | COCCOCOc1cc2ccc(C3CN(C(=O)OC(C)(C)C)C3)cc2c(F)c1N1CC(=O)NS1(=O)=O |
| InChI | InChI=1S/C24H30FN3O8S/c1-24(2,3)36-23(30)27-11-17(12-27)15-5-6-16-10-19(35-14-34-8-7-33-4)22(21(25)18(16)9-15)28-13-20(29)26-37(28,31)32/h5-6,9-10,17H,7-8,11-14H2,1-4H3,(H,26,29) |
| InChIKey | WFGSJYZQFQPQSN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|