C17H19FN2O8S — CID 156506565
5-[7-[(3R)-3,4-dihydroxy-3-methylbutoxy]-1-fluoro-3,6-dihydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 156506565) has the molecular formula C17H19FN2O8S and a molecular weight of 430.41 g/mol. Its IUPAC name is 5-[7-[(3R)-3,4-dihydroxy-3-methylbutoxy]-1-fluoro-3,6-dihydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[7-[(3R)-3,4-dihydroxy-3-methylbutoxy]-1-fluoro-3,6-dihydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 156506565 |
| Molecular Formula | C17H19FN2O8S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 5-[7-[(3R)-3,4-dihydroxy-3-methylbutoxy]-1-fluoro-3,6-dihydroxynaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | C[C@](O)(CO)CCOc1cc2c(F)c(N3CC(=O)NS3(=O)=O)c(O)cc2cc1O |
| InChI | InChI=1S/C17H19FN2O8S/c1-17(25,8-21)2-3-28-13-6-10-9(4-11(13)22)5-12(23)16(15(10)18)20-7-14(24)19-29(20,26)27/h4-6,21-23,25H,2-3,7-8H2,1H3,(H,19,24)/t17-/m1/s1 |
| InChIKey | UZSWKAQEMXGLMQ-QGZVFWFLSA-N |
| XLogP | 0.08 |
| TPSA | 156.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |