C21H28FN3O6S — CID 155103683
tert-butyl 3-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-1-carboxylate (PubChem CID 155103683) has the molecular formula C21H28FN3O6S and a molecular weight of 469.54 g/mol. Its IUPAC name is tert-butyl 3-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155103683 |
| Molecular Formula | C21H28FN3O6S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | tert-butyl 3-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2CCc3cc(O)c(N4CC(=O)NS4(=O)=O)c(F)c3C2)C1 |
| InChI | InChI=1S/C21H28FN3O6S/c1-21(2,3)31-20(28)24-7-6-14(10-24)12-4-5-13-9-16(26)19(18(22)15(13)8-12)25-11-17(27)23-32(25,29)30/h9,12,14,26H,4-8,10-11H2,1-3H3,(H,23,27) |
| InChIKey | NKPNHOCQBGMPBL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |