C16H20FN3O6S2 — CID 168884291
tert-butyl N-[(3S)-5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-2H-thiochromen-3-yl]carbamate (PubChem CID 168884291) has the molecular formula C16H20FN3O6S2 and a molecular weight of 433.48 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-2H-thiochromen-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-2H-thiochromen-3-yl]carbamate |
|---|---|
| PubChem CID | 168884291 |
| Molecular Formula | C16H20FN3O6S2 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | tert-butyl N-[(3S)-5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-2H-thiochromen-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CSc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C16H20FN3O6S2/c1-16(2,3)26-15(23)18-8-4-9-11(27-7-8)5-10(21)14(13(9)17)20-6-12(22)19-28(20,24)25/h5,8,21H,4,6-7H2,1-3H3,(H,18,23)(H,19,22)/t8-/m0/s1 |
| InChIKey | WRGCAUIFGUZCTF-QMMMGPOBSA-N |
| XLogP | 1.25 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |