C14H20N2O3S — CID 124709775
tert-butyl N-[(3S)-8-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]carbamate (PubChem CID 124709775) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is tert-butyl N-[(3S)-8-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-8-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]carbamate |
|---|---|
| PubChem CID | 124709775 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | tert-butyl N-[(3S)-8-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COc2cc(N)ccc2SC1 |
| InChI | InChI=1S/C14H20N2O3S/c1-14(2,3)19-13(17)16-10-7-18-11-6-9(15)4-5-12(11)20-8-10/h4-6,10H,7-8,15H2,1-3H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | OMRISPGHBSUJHB-JTQLQIEISA-N |
| XLogP | 2.65 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|