C16H22F3N3O2 — CID 141496913
tert-butyl N-[(3R)-1-[4-amino-2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate (PubChem CID 141496913) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[4-amino-2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[4-amino-2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 141496913 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl N-[(3R)-1-[4-amino-2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2ccc(N)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-15(2,3)24-14(23)21-11-6-7-22(9-11)13-5-4-10(20)8-12(13)16(17,18)19/h4-5,8,11H,6-7,9,20H2,1-3H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | FMORGXPCMTWLCN-LLVKDONJSA-N |
| XLogP | 3.39 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|