C18H22N2O2 — CID 51568108
4-(benzylamino)-6-methyl-1-[[(2S)-oxolan-2-yl]methyl]pyridin-2-one (PubChem CID 51568108) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-(benzylamino)-6-methyl-1-[[(2S)-oxolan-2-yl]methyl]pyridin-2-one.
| Compound Name | 4-(benzylamino)-6-methyl-1-[[(2S)-oxolan-2-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 51568108 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-(benzylamino)-6-methyl-1-[[(2S)-oxolan-2-yl]methyl]pyridin-2-one |
| SMILES | Cc1cc(NCc2ccccc2)cc(=O)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H22N2O2/c1-14-10-16(19-12-15-6-3-2-4-7-15)11-18(21)20(14)13-17-8-5-9-22-17/h2-4,6-7,10-11,17,19H,5,8-9,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | MDZPQHXDBCIFHQ-KRWDZBQOSA-N |
| XLogP | 2.95 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |